C10H12N2OS — CID 5271647
2-butyl-[1,2]thiazolo[5,4-b]pyridin-3-one (PubChem CID 5271647) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-butyl-[1,2]thiazolo[5,4-b]pyridin-3-one.
| Compound Name | 2-butyl-[1,2]thiazolo[5,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 5271647 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-butyl-[1,2]thiazolo[5,4-b]pyridin-3-one |
| SMILES | CCCCn1sc2ncccc2c1=O |
| InChI | InChI=1S/C10H12N2OS/c1-2-3-7-12-10(13)8-5-4-6-11-9(8)14-12/h4-6H,2-3,7H2,1H3 |
| InChIKey | HTWAQNHMRUCYRU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |