C11H15N3O — CID 24827424
2-pentyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 24827424) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-pentyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 2-pentyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 24827424 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-pentyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CCCCCn1[nH]c2ncccc2c1=O |
| InChI | InChI=1S/C11H15N3O/c1-2-3-4-8-14-11(15)9-6-5-7-12-10(9)13-14/h5-7H,2-4,8H2,1H3,(H,12,13) |
| InChIKey | DVOZEOXLGFATBD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|