C16H19N3O — CID 11722662
1-methyl-5-pentylimidazo[4,5-c]quinolin-4-one (PubChem CID 11722662) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-methyl-5-pentylimidazo[4,5-c]quinolin-4-one.
| Compound Name | 1-methyl-5-pentylimidazo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 11722662 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-methyl-5-pentylimidazo[4,5-c]quinolin-4-one |
| SMILES | CCCCCn1c(=O)c2ncn(C)c2c2ccccc21 |
| InChI | InChI=1S/C16H19N3O/c1-3-4-7-10-19-13-9-6-5-8-12(13)15-14(16(19)20)17-11-18(15)2/h5-6,8-9,11H,3-4,7,10H2,1-2H3 |
| InChIKey | ZODMRMKETGMHRM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|