C16H17N3O — CID 10355619
5-cyclopentyl-1-methylimidazo[4,5-c]quinolin-4-one (PubChem CID 10355619) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-cyclopentyl-1-methylimidazo[4,5-c]quinolin-4-one.
| Compound Name | 5-cyclopentyl-1-methylimidazo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 10355619 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 5-cyclopentyl-1-methylimidazo[4,5-c]quinolin-4-one |
| SMILES | Cn1cnc2c(=O)n(C3CCCC3)c3ccccc3c21 |
| InChI | InChI=1S/C16H17N3O/c1-18-10-17-14-15(18)12-8-4-5-9-13(12)19(16(14)20)11-6-2-3-7-11/h4-5,8-11H,2-3,6-7H2,1H3 |
| InChIKey | DTMCXUDKTMUVIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |