C15H12N2O3S — CID 10017665
ethyl 4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate (PubChem CID 10017665) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is ethyl 4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate.
| Compound Name | ethyl 4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate |
|---|---|
| PubChem CID | 10017665 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethyl 4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2sc3ncccc3c2=O)cc1 |
| InChI | InChI=1S/C15H12N2O3S/c1-2-20-15(19)10-5-7-11(8-6-10)17-14(18)12-4-3-9-16-13(12)21-17/h3-9H,2H2,1H3 |
| InChIKey | NMEUEJLABIVOAB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |