C22H20N4O4S — CID 50760969
ethyl 4-[2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoylamino]benzoate (PubChem CID 50760969) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is ethyl 4-[2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoylamino]benzoate.
| Compound Name | ethyl 4-[2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 50760969 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | ethyl 4-[2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)n2cnc3c(sc4ncccc43)c2=O)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-3-16(19(27)25-14-9-7-13(8-10-14)22(29)30-4-2)26-12-24-17-15-6-5-11-23-20(15)31-18(17)21(26)28/h5-12,16H,3-4H2,1-2H3,(H,25,27) |
| InChIKey | RUTKKVYZLZKCPU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |