C21H18N4O4S — CID 94069521
methyl 4-[[(2S)-2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoyl]amino]benzoate (PubChem CID 94069521) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoyl]amino]benzoate.
| Compound Name | methyl 4-[[(2S)-2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 94069521 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | methyl 4-[[(2S)-2-(6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)butanoyl]amino]benzoate |
| SMILES | CC[C@@H](C(=O)Nc1ccc(C(=O)OC)cc1)n1cnc2c(sc3ncccc32)c1=O |
| InChI | InChI=1S/C21H18N4O4S/c1-3-15(18(26)24-13-8-6-12(7-9-13)21(28)29-2)25-11-23-16-14-5-4-10-22-19(14)30-17(16)20(25)27/h4-11,15H,3H2,1-2H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | XNAAKEQCRZFELN-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |