About ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate
ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate (PubChem CID 10335843) has the molecular formula C15H13N3O3S
and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate |
| PubChem CID | 10335843 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(-n2sc3ncccc3c2=O)cc1 |
| InChI | InChI=1S/C15H13N3O3S/c1-2-21-15(20)17-10-5-7-11(8-6-10)18-14(19)12-4-3-9-16-13(12)22-18/h3-9H,2H2,1H3,(H,17,20) |
| InChIKey | MXURCSQBKHCVEE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate?
The IUPAC name of ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate (CID 10335843) is ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate.
What is the SMILES notation for ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate?
The canonical SMILES for ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate is CCOC(=O)Nc1ccc(-n2sc3ncccc3c2=O)cc1.
What is the InChIKey of ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate?
The InChIKey is MXURCSQBKHCVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O3S/c1-2-21-15(20)17-10-5-7-11(8-6-10)18-14(19)12-4-3-9-16-13(12)22-18/h3-9H,2H2,1H3,(H,17,20).
What are the key properties of ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate?
ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate has a molecular weight of 315.35 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[4-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)phenyl]carbamate is sourced from PubChem (CID 10335843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).