methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate

C14H10N2O3S — CID 10016832

IUPACmethyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate
SMILESCOC(=O)c1ccccc1-n1sc2ncccc2c1=O
InChIInChI=1S/C14H10N2O3S/c1-19-14(18)9-5-2-3-7-11(9)16-13(17)10-6-4-8-15-12(10)20-16/h2-8H,1H3
InChIKeyFLVGZHXMUUQYFZ-UHFFFAOYSA-N
MW286.31 g/mol
LogP2.23
Rot. Bonds2

About methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate

methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate (PubChem CID 10016832) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate
PubChem CID10016832
Molecular FormulaC14H10N2O3S
Molecular Weight286.31 g/mol
Exact Mass286.04
IUPAC Namemethyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate
SMILESCOC(=O)c1ccccc1-n1sc2ncccc2c1=O
InChIInChI=1S/C14H10N2O3S/c1-19-14(18)9-5-2-3-7-11(9)16-13(17)10-6-4-8-15-12(10)20-16/h2-8H,1H3
InChIKeyFLVGZHXMUUQYFZ-UHFFFAOYSA-N
XLogP2.23
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.31
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate?
The IUPAC name of methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate (CID 10016832) is methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate.
What is the SMILES notation for methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate?
The canonical SMILES for methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate is COC(=O)c1ccccc1-n1sc2ncccc2c1=O.
What is the InChIKey of methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate?
The InChIKey is FLVGZHXMUUQYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3S/c1-19-14(18)9-5-2-3-7-11(9)16-13(17)10-6-4-8-15-12(10)20-16/h2-8H,1H3.
What are the key properties of methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate?
methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate has a molecular weight of 286.31 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate is sourced from PubChem (CID 10016832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).