C14H10N2O3S — CID 10016832
methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate (PubChem CID 10016832) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate.
| Compound Name | methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate |
|---|---|
| PubChem CID | 10016832 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | methyl 2-(3-oxo-[1,2]thiazolo[5,4-b]pyridin-2-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-n1sc2ncccc2c1=O |
| InChI | InChI=1S/C14H10N2O3S/c1-19-14(18)9-5-2-3-7-11(9)16-13(17)10-6-4-8-15-12(10)20-16/h2-8H,1H3 |
| InChIKey | FLVGZHXMUUQYFZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |