C14H12N2O3S — CID 11778852
2-(2,5-dimethoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one (PubChem CID 11778852) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one.
| Compound Name | 2-(2,5-dimethoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 11778852 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| SMILES | COc1ccc(OC)c(-n2sc3ncccc3c2=O)c1 |
| InChI | InChI=1S/C14H12N2O3S/c1-18-9-5-6-12(19-2)11(8-9)16-14(17)10-4-3-7-15-13(10)20-16/h3-8H,1-2H3 |
| InChIKey | IRRSODHCSGXJNK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |