C20H23N2O3S+ — CID 2435966
diethyl-[2-[4-(3-oxo-1,2-benzothiazol-2-yl)benzoyl]oxyethyl]azanium (PubChem CID 2435966) has the molecular formula C20H23N2O3S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is diethyl-[2-[4-(3-oxo-1,2-benzothiazol-2-yl)benzoyl]oxyethyl]azanium.
| Compound Name | diethyl-[2-[4-(3-oxo-1,2-benzothiazol-2-yl)benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 2435966 |
| Molecular Formula | C20H23N2O3S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | diethyl-[2-[4-(3-oxo-1,2-benzothiazol-2-yl)benzoyl]oxyethyl]azanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(-n2sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-21(4-2)13-14-25-20(24)15-9-11-16(12-10-15)22-19(23)17-7-5-6-8-18(17)26-22/h5-12H,3-4,13-14H2,1-2H3/p+1 |
| InChIKey | GPDZDGRYESPHKI-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |