C28H31N4O2S+ — CID 7040283
diethyl-[2-[4-[3-(phenylcarbamothioylimino)-1H-isoindol-2-yl]benzoyl]oxyethyl]azanium (PubChem CID 7040283) has the molecular formula C28H31N4O2S+ and a molecular weight of 487.65 g/mol. Its IUPAC name is diethyl-[2-[4-[3-(phenylcarbamothioylimino)-1H-isoindol-2-yl]benzoyl]oxyethyl]azanium.
| Compound Name | diethyl-[2-[4-[3-(phenylcarbamothioylimino)-1H-isoindol-2-yl]benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 7040283 |
| Molecular Formula | C28H31N4O2S+ |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | diethyl-[2-[4-[3-(phenylcarbamothioylimino)-1H-isoindol-2-yl]benzoyl]oxyethyl]azanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(N2Cc3ccccc3C2=NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4O2S/c1-3-31(4-2)18-19-34-27(33)21-14-16-24(17-15-21)32-20-22-10-8-9-13-25(22)26(32)30-28(35)29-23-11-6-5-7-12-23/h5-17H,3-4,18-20H2,1-2H3,(H,29,35)/p+1 |
| InChIKey | POGKRNLMYQLFOI-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|