C15H10N2O2S — CID 172877478
2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzonitrile (PubChem CID 172877478) has the molecular formula C15H10N2O2S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzonitrile.
| Compound Name | 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 172877478 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzonitrile |
| SMILES | COc1cc(-n2sc3ccccc3c2=O)ccc1C#N |
| InChI | InChI=1S/C15H10N2O2S/c1-19-13-8-11(7-6-10(13)9-16)17-15(18)12-4-2-3-5-14(12)20-17/h2-8H,1H3 |
| InChIKey | DIYHFPFBVLWTHY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |