C15H11NO4S — CID 107209126
2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid (PubChem CID 107209126) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid.
| Compound Name | 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 107209126 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-methoxy-4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid |
| SMILES | COc1cc(-n2sc3ccccc3c2=O)ccc1C(=O)O |
| InChI | InChI=1S/C15H11NO4S/c1-20-12-8-9(6-7-10(12)15(18)19)16-14(17)11-4-2-3-5-13(11)21-16/h2-8H,1H3,(H,18,19) |
| InChIKey | HEWWRMOQKBKKSF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |