C13H16N2O — CID 70960747
2-methoxy-4-[(2S)-2-methylpyrrolidin-1-yl]benzonitrile (PubChem CID 70960747) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-methoxy-4-[(2S)-2-methylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 2-methoxy-4-[(2S)-2-methylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70960747 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-methoxy-4-[(2S)-2-methylpyrrolidin-1-yl]benzonitrile |
| SMILES | COc1cc(N2CCC[C@@H]2C)ccc1C#N |
| InChI | InChI=1S/C13H16N2O/c1-10-4-3-7-15(10)12-6-5-11(9-14)13(8-12)16-2/h5-6,8,10H,3-4,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | TXRFYZYHQGXQRX-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |