C11H12N2O — CID 145148280
5-ethyl-7-methyl-1,7-naphthyridin-8-one (PubChem CID 145148280) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-ethyl-7-methyl-1,7-naphthyridin-8-one.
| Compound Name | 5-ethyl-7-methyl-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 145148280 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5-ethyl-7-methyl-1,7-naphthyridin-8-one |
| SMILES | CCc1cn(C)c(=O)c2ncccc12 |
| InChI | InChI=1S/C11H12N2O/c1-3-8-7-13(2)11(14)10-9(8)5-4-6-12-10/h4-7H,3H2,1-2H3 |
| InChIKey | KBAIVHJOKNAEKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |