C14H20N4O — CID 145029081
8-(hexan-3-ylamino)-6-methylpyrido[2,3-d]pyridazin-5-one (PubChem CID 145029081) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 8-(hexan-3-ylamino)-6-methylpyrido[2,3-d]pyridazin-5-one.
| Compound Name | 8-(hexan-3-ylamino)-6-methylpyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 145029081 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 8-(hexan-3-ylamino)-6-methylpyrido[2,3-d]pyridazin-5-one |
| SMILES | CCCC(CC)Nc1nn(C)c(=O)c2cccnc12 |
| InChI | InChI=1S/C14H20N4O/c1-4-7-10(5-2)16-13-12-11(8-6-9-15-12)14(19)18(3)17-13/h6,8-10H,4-5,7H2,1-3H3,(H,16,17) |
| InChIKey | MMVZTSBOHMSAGF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |