About 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine
3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine (PubChem CID 103096852) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine |
| PubChem CID | 103096852 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine |
| SMILES | CCCC(CC)Nc1cccnc1N(C)C |
| InChI | InChI=1S/C13H23N3/c1-5-8-11(6-2)15-12-9-7-10-14-13(12)16(3)4/h7,9-11,15H,5-6,8H2,1-4H3 |
| InChIKey | FAXUJTOUYREIPE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine?
The IUPAC name of 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine (CID 103096852) is 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine.
What is the SMILES notation for 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine?
The canonical SMILES for 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine is CCCC(CC)Nc1cccnc1N(C)C.
What is the InChIKey of 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine?
The InChIKey is FAXUJTOUYREIPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-5-8-11(6-2)15-12-9-7-10-14-13(12)16(3)4/h7,9-11,15H,5-6,8H2,1-4H3.
What are the key properties of 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine?
3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine has a molecular weight of 221.35 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-hexan-3-yl-2-N,2-N-dimethylpyridine-2,3-diamine is sourced from PubChem (CID 103096852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).