About 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine
3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine (PubChem CID 43707987) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine |
| PubChem CID | 43707987 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine |
| SMILES | CCCCNc1cccnc1N(C)C |
| InChI | InChI=1S/C11H19N3/c1-4-5-8-12-10-7-6-9-13-11(10)14(2)3/h6-7,9,12H,4-5,8H2,1-3H3 |
| InChIKey | JVRMBGJUKIRVAL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine?
The IUPAC name of 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine (CID 43707987) is 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine.
What is the SMILES notation for 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine?
The canonical SMILES for 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine is CCCCNc1cccnc1N(C)C.
What is the InChIKey of 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine?
The InChIKey is JVRMBGJUKIRVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-4-5-8-12-10-7-6-9-13-11(10)14(2)3/h6-7,9,12H,4-5,8H2,1-3H3.
What are the key properties of 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine?
3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine has a molecular weight of 193.29 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine is sourced from PubChem (CID 43707987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).