C11H19N3 — CID 43707987
3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine (PubChem CID 43707987) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine.
| Compound Name | 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 43707987 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-N-butyl-2-N,2-N-dimethylpyridine-2,3-diamine |
| SMILES | CCCCNc1cccnc1N(C)C |
| InChI | InChI=1S/C11H19N3/c1-4-5-8-12-10-7-6-9-13-11(10)14(2)3/h6-7,9,12H,4-5,8H2,1-3H3 |
| InChIKey | JVRMBGJUKIRVAL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|