C12H11N3 — CID 129265266
5-ethylpyrazino[2,3-b]indole (PubChem CID 129265266) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-ethylpyrazino[2,3-b]indole.
| Compound Name | 5-ethylpyrazino[2,3-b]indole |
|---|---|
| PubChem CID | 129265266 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-ethylpyrazino[2,3-b]indole |
| SMILES | CCn1c2ccccc2c2nccnc21 |
| InChI | InChI=1S/C12H11N3/c1-2-15-10-6-4-3-5-9(10)11-12(15)14-8-7-13-11/h3-8H,2H2,1H3 |
| InChIKey | YQWZGDRXRBSKSD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |