C13H11IrN2- — CID 59459735
5-ethyl-9H-pyrido[3,2-b]indol-9-ide;iridium (PubChem CID 59459735) has the molecular formula C13H11IrN2- and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-ethyl-9H-pyrido[3,2-b]indol-9-ide;iridium.
| Compound Name | 5-ethyl-9H-pyrido[3,2-b]indol-9-ide;iridium |
|---|---|
| PubChem CID | 59459735 |
| Molecular Formula | C13H11IrN2- |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 5-ethyl-9H-pyrido[3,2-b]indol-9-ide;iridium |
| SMILES | CCn1c2ccc[c-]c2c2ncccc21.[Ir] |
| InChI | InChI=1S/C13H11N2.Ir/c1-2-15-11-7-4-3-6-10(11)13-12(15)8-5-9-14-13;/h3-5,7-9H,2H2,1H3;/q-1; |
| InChIKey | APYGELSIOFJVHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|