C30H26N8 — CID 171509587
[4,6-bis(5-ethylpyrido[3,2-b]indol-8-yl)-1,3,5-triazin-2-yl]methanamine (PubChem CID 171509587) has the molecular formula C30H26N8 and a molecular weight of 498.59 g/mol. Its IUPAC name is [4,6-bis(5-ethylpyrido[3,2-b]indol-8-yl)-1,3,5-triazin-2-yl]methanamine.
| Compound Name | [4,6-bis(5-ethylpyrido[3,2-b]indol-8-yl)-1,3,5-triazin-2-yl]methanamine |
|---|---|
| PubChem CID | 171509587 |
| Molecular Formula | C30H26N8 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [4,6-bis(5-ethylpyrido[3,2-b]indol-8-yl)-1,3,5-triazin-2-yl]methanamine |
| SMILES | CCn1c2ccc(-c3nc(CN)nc(-c4ccc5c(c4)c4ncccc4n5CC)n3)cc2c2ncccc21 |
| InChI | InChI=1S/C30H26N8/c1-3-37-22-11-9-18(15-20(22)27-24(37)7-5-13-32-27)29-34-26(17-31)35-30(36-29)19-10-12-23-21(16-19)28-25(38(23)4-2)8-6-14-33-28/h5-16H,3-4,17,31H2,1-2H3 |
| InChIKey | XYOZIOSIHOIWCY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |