C16H8IrN5- — CID 164805533
CID 164805533 (PubChem CID 164805533) has the molecular formula C16H8IrN5- and a molecular weight of 462.49 g/mol.
| Compound Name | CID 164805533 |
|---|---|
| PubChem CID | 164805533 |
| Molecular Formula | C16H8IrN5- |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2c1c1ncccc1c1nc3nccnc3n21 |
| InChI | InChI=1S/C16H8N5.Ir/c1-2-6-12-10(4-1)13-11(5-3-7-17-13)15-20-14-16(21(12)15)19-9-8-18-14;/h1-3,5-9H;/q-1; |
| InChIKey | NIWBVTUYMNYBIW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|