C16H13N4Pd-3 — CID 171726760
azanide;palladium;5H-phenanthro[9,10-b]pyrazin-5-ide (PubChem CID 171726760) has the molecular formula C16H13N4Pd-3 and a molecular weight of 367.73 g/mol. Its IUPAC name is azanide;palladium;5H-phenanthro[9,10-b]pyrazin-5-ide.
| Compound Name | azanide;palladium;5H-phenanthro[9,10-b]pyrazin-5-ide |
|---|---|
| PubChem CID | 171726760 |
| Molecular Formula | C16H13N4Pd-3 |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | azanide;palladium;5H-phenanthro[9,10-b]pyrazin-5-ide |
| SMILES | [NH2-].[NH2-].[Pd].[c-]1cccc2c1c1nccnc1c1ccccc21 |
| InChI | InChI=1S/C16H9N2.2H2N.Pd/c1-3-7-13-11(5-1)12-6-2-4-8-14(12)16-15(13)17-9-10-18-16;;;/h1-7,9-10H;2*1H2;/q3*-1; |
| InChIKey | JDNZNOPBOFDSBI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 92.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|