C28H31IrN2O2- — CID 146691033
5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-methyl-12H-phenanthro[9,10-b]pyrazin-12-ide (PubChem CID 146691033) has the molecular formula C28H31IrN2O2- and a molecular weight of 619.79 g/mol. Its IUPAC name is 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-methyl-12H-phenanthro[9,10-b]pyrazin-12-ide.
| Compound Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-methyl-12H-phenanthro[9,10-b]pyrazin-12-ide |
|---|---|
| PubChem CID | 146691033 |
| Molecular Formula | C28H31IrN2O2- |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;3-methyl-12H-phenanthro[9,10-b]pyrazin-12-ide |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C.Cc1cnc2c3[c-]cccc3c3ccccc3c2n1.[Ir] |
| InChI | InChI=1S/C17H11N2.C11H20O2.Ir/c1-11-10-18-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17(16)19-11;1-10(2,3)8(12)7-9(13)11(4,5)6;/h2-7,9-10H,1H3;7,12H,1-6H3;/q-1;; |
| InChIKey | FCVJSOSCWMDSCC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|