C29H34IrNO2- — CID 58239768
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 58239768) has the molecular formula C29H34IrNO2- and a molecular weight of 620.81 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 58239768 |
| Molecular Formula | C29H34IrNO2- |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.[Ir] |
| InChI | InChI=1S/C18H14N.C11H20O2.Ir/c1-14-10-11-18(19-13-14)17-9-5-8-16(12-17)15-6-3-2-4-7-15;1-10(2,3)8(12)7-9(13)11(4,5)6;/h2-8,10-13H,1H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | LQSVFEOSSSDSJL-HXIBTQJOSA-N |
| XLogP | 7.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|