C26H25F3IrN3O- — CID 148703950
iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;4,4,4-trifluoro-3-methyl-1-pyrazol-1-ylbutan-2-ol (PubChem CID 148703950) has the molecular formula C26H25F3IrN3O- and a molecular weight of 644.72 g/mol. Its IUPAC name is iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;4,4,4-trifluoro-3-methyl-1-pyrazol-1-ylbutan-2-ol.
| Compound Name | iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;4,4,4-trifluoro-3-methyl-1-pyrazol-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 148703950 |
| Molecular Formula | C26H25F3IrN3O- |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | iridium;5-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;4,4,4-trifluoro-3-methyl-1-pyrazol-1-ylbutan-2-ol |
| SMILES | CC(C(O)Cn1cccn1)C(F)(F)F.Cc1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.[Ir] |
| InChI | InChI=1S/C18H14N.C8H11F3N2O.Ir/c1-14-10-11-18(19-13-14)17-9-5-8-16(12-17)15-6-3-2-4-7-15;1-6(8(9,10)11)7(14)5-13-4-2-3-12-13;/h2-8,10-13H,1H3;2-4,6-7,14H,5H2,1H3;/q-1;; |
| InChIKey | CKGHBLIRFUYERW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|