C18H13FIrN- — CID 58239769
2-(4-fluoro-3-phenylbenzene-6-id-1-yl)-5-methylpyridine;iridium (PubChem CID 58239769) has the molecular formula C18H13FIrN- and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-(4-fluoro-3-phenylbenzene-6-id-1-yl)-5-methylpyridine;iridium.
| Compound Name | 2-(4-fluoro-3-phenylbenzene-6-id-1-yl)-5-methylpyridine;iridium |
|---|---|
| PubChem CID | 58239769 |
| Molecular Formula | C18H13FIrN- |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-(4-fluoro-3-phenylbenzene-6-id-1-yl)-5-methylpyridine;iridium |
| SMILES | Cc1ccc(-c2[c-]cc(F)c(-c3ccccc3)c2)nc1.[Ir] |
| InChI | InChI=1S/C18H13FN.Ir/c1-13-7-10-18(20-12-13)15-8-9-17(19)16(11-15)14-5-3-2-4-6-14;/h2-7,9-12H,1H3;/q-1; |
| InChIKey | JDRPWRRAOWKVKT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|