C36H26IrN2O-2 — CID 162486024
CID 162486024 (PubChem CID 162486024) has the molecular formula C36H26IrN2O-2 and a molecular weight of 694.83 g/mol.
| Compound Name | CID 162486024 |
|---|---|
| PubChem CID | 162486024 |
| Molecular Formula | C36H26IrN2O-2 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 695.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2[c-]cc3c(c2)-c2ccccc2-c2ccccc2O3)nc1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C24H16NO.C12H10N.Ir/c1-16-10-12-22(25-15-16)17-11-13-24-21(14-17)19-7-3-2-6-18(19)20-8-4-5-9-23(20)26-24;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-10,12-15H,1H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | CSFMBQANGUWFQK-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|