C31H33N2O2Pt- — CID 58019486
3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum (PubChem CID 58019486) has the molecular formula C31H33N2O2Pt- and a molecular weight of 660.70 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum.
| Compound Name | 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum |
|---|---|
| PubChem CID | 58019486 |
| Molecular Formula | C31H33N2O2Pt- |
| Molecular Weight | 660.70 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | 3-(4-tert-butylphenyl)-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum |
| SMILES | CC(C)(C)c1ccc(-c2cnc3c4[c-]cccc4c4ccccc4c3n2)cc1.CC(O)CC(C)O.[Pt] |
| InChI | InChI=1S/C26H21N2.C5H12O2.Pt/c1-26(2,3)18-14-12-17(13-15-18)23-16-27-24-21-10-6-4-8-19(21)20-9-5-7-11-22(20)25(24)28-23;1-4(6)3-5(2)7;/h4-9,11-16H,1-3H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | ZHBCKSWWFDBJNX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|