C29H29N2O2Pt- — CID 58019519
7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum (PubChem CID 58019519) has the molecular formula C29H29N2O2Pt- and a molecular weight of 632.64 g/mol. Its IUPAC name is 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum.
| Compound Name | 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum |
|---|---|
| PubChem CID | 58019519 |
| Molecular Formula | C29H29N2O2Pt- |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 7,10-dimethyl-3-phenyl-12H-phenanthro[9,10-b]pyrazin-12-ide;pentane-2,4-diol;platinum |
| SMILES | CC(O)CC(C)O.Cc1c[c-]c2c(c1)c1cc(C)ccc1c1nc(-c3ccccc3)cnc21.[Pt] |
| InChI | InChI=1S/C24H17N2.C5H12O2.Pt/c1-15-8-10-18-20(12-15)21-13-16(2)9-11-19(21)24-23(18)25-14-22(26-24)17-6-4-3-5-7-17;1-4(6)3-5(2)7;/h3-9,11-14H,1-2H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | UFCPEZKEXNWLRH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|