C24H28IrNO3Se- — CID 153460776
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;7-(phenoxy)selenopheno[2,3-c]pyridine (PubChem CID 153460776) has the molecular formula C24H28IrNO3Se- and a molecular weight of 649.67 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;7-(phenoxy)selenopheno[2,3-c]pyridine.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;7-(phenoxy)selenopheno[2,3-c]pyridine |
|---|---|
| PubChem CID | 153460776 |
| Molecular Formula | C24H28IrNO3Se- |
| Molecular Weight | 649.67 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;7-(phenoxy)selenopheno[2,3-c]pyridine |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1ccccc1Oc1nccc2cc[se]c12 |
| InChI | InChI=1S/C13H8NOSe.C11H20O2.Ir/c1-2-4-11(5-3-1)15-13-12-10(6-8-14-13)7-9-16-12;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-4,6-9H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | UDSSDIICFWGDOB-HXIBTQJOSA-N |
| XLogP | 5.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|