C24H25NY3-4 — CID 159763189
ethane;9-ethyl-3-phenyl-2,4-dihydrocarbazole-2,4-diide;tris(yttrium) (PubChem CID 159763189) has the molecular formula C24H25NY3-4 and a molecular weight of 594.19 g/mol. Its IUPAC name is ethane;9-ethyl-3-phenyl-2,4-dihydrocarbazole-2,4-diide;tris(yttrium).
| Compound Name | ethane;9-ethyl-3-phenyl-2,4-dihydrocarbazole-2,4-diide;tris(yttrium) |
|---|---|
| PubChem CID | 159763189 |
| Molecular Formula | C24H25NY3-4 |
| Molecular Weight | 594.19 g/mol |
| Exact Mass | 593.92 |
| IUPAC Name | ethane;9-ethyl-3-phenyl-2,4-dihydrocarbazole-2,4-diide;tris(yttrium) |
| SMILES | CC.CC.CCn1c2c[c-]c(-c3[c-]ccc[c-]3)[c-]c2c2ccccc21.[Y].[Y].[Y] |
| InChI | InChI=1S/C20H13N.2C2H6.3Y/c1-2-21-19-11-7-6-10-17(19)18-14-16(12-13-20(18)21)15-8-4-3-5-9-15;2*1-2;;;/h3-7,10-11,13H,2H2,1H3;2*1-2H3;;;/q-4;;;;; |
| InChIKey | WXFIZQUBWCGLAG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.19 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|