C25H21NY2-2 — CID 161495175
9-[(Z,2E)-2-ethylidenepent-3-enyl]-3-phenyl-4H-carbazol-4-ide;bis(yttrium) (PubChem CID 161495175) has the molecular formula C25H21NY2-2 and a molecular weight of 513.26 g/mol. Its IUPAC name is 9-[(Z,2E)-2-ethylidenepent-3-enyl]-3-phenyl-4H-carbazol-4-ide;bis(yttrium).
| Compound Name | 9-[(Z,2E)-2-ethylidenepent-3-enyl]-3-phenyl-4H-carbazol-4-ide;bis(yttrium) |
|---|---|
| PubChem CID | 161495175 |
| Molecular Formula | C25H21NY2-2 |
| Molecular Weight | 513.26 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | 9-[(Z,2E)-2-ethylidenepent-3-enyl]-3-phenyl-4H-carbazol-4-ide;bis(yttrium) |
| SMILES | C/C=C\C(=C/C)Cn1c2ccc(-c3[c-]cccc3)[c-]c2c2ccccc21.[Y].[Y] |
| InChI | InChI=1S/C25H21N.2Y/c1-3-10-19(4-2)18-26-24-14-9-8-13-22(24)23-17-21(15-16-25(23)26)20-11-6-5-7-12-20;;/h3-11,13-16H,18H2,1-2H3;;/q-2;;/b10-3-,19-4+;; |
| InChIKey | ULNAVWNGNLJUOX-IPBJCGKRSA-N |
| XLogP | 6.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.26 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|