About CID 164795970
CID 164795970 (PubChem CID 164795970) has the molecular formula C34H25IrN4
and a molecular weight of 681.82 g/mol.
Molecular Properties
| Compound Name | CID 164795970 |
| PubChem CID | 164795970 |
| Molecular Formula | C34H25IrN4 |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | — |
| SMILES | CN1C=CN(c2[c-]c3c4cccc5c6ccccc6n(c3cc2)c45)[CH-]1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir+3] |
| InChI | InChI=1S/C22H15N3.C12H10N.Ir/c1-23-11-12-24(14-23)15-9-10-21-19(13-15)18-7-4-6-17-16-5-2-3-8-20(16)25(21)22(17)18;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-12,14H,1H3;2-5,7-9H,1H3;/q-2;-1;+3 |
| InChIKey | RDOLPUURSKNZDX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 164795970 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164795970?
The IUPAC name of CID 164795970 (CID 164795970) is not available.
What is the SMILES notation for CID 164795970?
The canonical SMILES for CID 164795970 is CN1C=CN(c2[c-]c3c4cccc5c6ccccc6n(c3cc2)c45)[CH-]1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir+3].
What is the InChIKey of CID 164795970?
The InChIKey is RDOLPUURSKNZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N3.C12H10N.Ir/c1-23-11-12-24(14-23)15-9-10-21-19(13-15)18-7-4-6-17-16-5-2-3-8-20(16)25(21)22(17)18;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-12,14H,1H3;2-5,7-9H,1H3;/q-2;-1;+3.
What are the key properties of CID 164795970?
CID 164795970 has a molecular weight of 681.82 g/mol, XLogP of 7.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164795970 is sourced from PubChem (CID 164795970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).