C44H28IrN4O-2 — CID 176796444
18-(3H-dibenzofuran-3-id-4-yl)-19-methyl-1,17,19-triazahexacyclo[10.9.1.02,7.08,22.013,21.016,20]docosa-2,4,6,8(22),9,11,13(21),14,16(20),17-decaene;iridium;5-methyl-2-phenylpyridine (PubChem CID 176796444) has the molecular formula C44H28IrN4O-2 and a molecular weight of 820.95 g/mol. Its IUPAC name is 18-(3H-dibenzofuran-3-id-4-yl)-19-methyl-1,17,19-triazahexacyclo[10.9.1.02,7.08,22.013,21.016,20]docosa-2,4,6,8(22),9,11,13(21),14,16(20),17-decaene;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 18-(3H-dibenzofuran-3-id-4-yl)-19-methyl-1,17,19-triazahexacyclo[10.9.1.02,7.08,22.013,21.016,20]docosa-2,4,6,8(22),9,11,13(21),14,16(20),17-decaene;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 176796444 |
| Molecular Formula | C44H28IrN4O-2 |
| Molecular Weight | 820.95 g/mol |
| Exact Mass | 821.19 |
| IUPAC Name | 18-(3H-dibenzofuran-3-id-4-yl)-19-methyl-1,17,19-triazahexacyclo[10.9.1.02,7.08,22.013,21.016,20]docosa-2,4,6,8(22),9,11,13(21),14,16(20),17-decaene;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.Cn1c(-c2[c-]ccc3c2oc2ccccc23)nc2ccc3c4cccc5c6ccccc6n(c54)c3c21.[Ir] |
| InChI | InChI=1S/C32H18N3O.C12H10N.Ir/c1-34-30-25(33-32(34)24-13-7-12-23-19-9-3-5-15-27(19)36-31(23)24)17-16-22-21-11-6-10-20-18-8-2-4-14-26(18)35(28(20)21)29(22)30;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-12,14-17H,1H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | WIAJGIVOGPJRCO-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 48.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.95 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|