C42H28IrN4-2 — CID 176796323
iridium;5-methyl-2-phenylpyridine;9-methyl-8-phenyl-7,9,15-triazaheptacyclo[13.10.1.02,14.03,11.06,10.016,21.022,26]hexacosa-1(25),2(14),3(11),4,6(10),7,12,16,18,20,22(26),23-dodecaene (PubChem CID 176796323) has the molecular formula C42H28IrN4-2 and a molecular weight of 780.93 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;9-methyl-8-phenyl-7,9,15-triazaheptacyclo[13.10.1.02,14.03,11.06,10.016,21.022,26]hexacosa-1(25),2(14),3(11),4,6(10),7,12,16,18,20,22(26),23-dodecaene.
| Compound Name | iridium;5-methyl-2-phenylpyridine;9-methyl-8-phenyl-7,9,15-triazaheptacyclo[13.10.1.02,14.03,11.06,10.016,21.022,26]hexacosa-1(25),2(14),3(11),4,6(10),7,12,16,18,20,22(26),23-dodecaene |
|---|---|
| PubChem CID | 176796323 |
| Molecular Formula | C42H28IrN4-2 |
| Molecular Weight | 780.93 g/mol |
| Exact Mass | 781.20 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;9-methyl-8-phenyl-7,9,15-triazaheptacyclo[13.10.1.02,14.03,11.06,10.016,21.022,26]hexacosa-1(25),2(14),3(11),4,6(10),7,12,16,18,20,22(26),23-dodecaene |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.Cn1c(-c2[c-]cccc2)nc2ccc3c(ccc4c3c3cccc5c6ccccc6n4c53)c21.[Ir] |
| InChI | InChI=1S/C30H18N3.C12H10N.Ir/c1-32-29-22-15-17-26-27(20(22)14-16-24(29)31-30(32)18-8-3-2-4-9-18)23-12-7-11-21-19-10-5-6-13-25(19)33(26)28(21)23;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-8,10-17H,1H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | PWWWMIVWOJWGKV-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.93 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|