C12H15N3 — CID 148771611
1-(3-ethyl-1-methylpyrrolo[3,2-b]pyridin-2-yl)-N-methylmethanimine (PubChem CID 148771611) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrrolo[3,2-b]pyridin-2-yl)-N-methylmethanimine.
| Compound Name | 1-(3-ethyl-1-methylpyrrolo[3,2-b]pyridin-2-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 148771611 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrrolo[3,2-b]pyridin-2-yl)-N-methylmethanimine |
| SMILES | CCc1c(/C=N/C)n(C)c2cccnc12 |
| InChI | InChI=1S/C12H15N3/c1-4-9-11(8-13-2)15(3)10-6-5-7-14-12(9)10/h5-8H,4H2,1-3H3/b13-8+ |
| InChIKey | OINFESAHDUEIOS-MDWZMJQESA-N |
| XLogP | 2.18 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|