C25H20N6 — CID 6220193
2-ethyl-3-methyl-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 6220193) has the molecular formula C25H20N6 and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 2-ethyl-3-methyl-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 6220193 |
| Molecular Formula | C25H20N6 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-ethyl-3-methyl-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCc1c(C)c(C#N)c2nc3ccccc3n2c1N/N=C\c1cccc2cccnc12 |
| InChI | InChI=1S/C25H20N6/c1-3-19-16(2)20(14-26)24-29-21-11-4-5-12-22(21)31(24)25(19)30-28-15-18-9-6-8-17-10-7-13-27-23(17)18/h4-13,15,30H,3H2,1-2H3/b28-15- |
| InChIKey | CZCHNYRIWCYETD-MBTHVWNTSA-N |
| XLogP | 5.22 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|