C26H22N6O — CID 135608233
2-ethyl-3-methyl-1-[(2E)-2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 135608233) has the molecular formula C26H22N6O and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1-[(2E)-2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 2-ethyl-3-methyl-1-[(2E)-2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 135608233 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-ethyl-3-methyl-1-[(2E)-2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methylidene]hydrazinyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCc1c(C)c(C#N)c2nc3ccccc3n2c1N/N=C/c1cc2cc(C)ccc2[nH]c1=O |
| InChI | InChI=1S/C26H22N6O/c1-4-19-16(3)20(13-27)24-29-22-7-5-6-8-23(22)32(24)25(19)31-28-14-18-12-17-11-15(2)9-10-21(17)30-26(18)33/h5-12,14,31H,4H2,1-3H3,(H,30,33)/b28-14+ |
| InChIKey | CZJCOVRUHFWGSY-CCVNUDIWSA-N |
| XLogP | 4.83 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|