C28H27N7 — CID 6220094
1-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-2-ethyl-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 6220094) has the molecular formula C28H27N7 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-2-ethyl-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-2-ethyl-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 6220094 |
| Molecular Formula | C28H27N7 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 1-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-2-ethyl-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCc1c(C)c(C#N)c2nc3ccccc3n2c1N/N=C\c1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C28H27N7/c1-5-22-18(2)23(15-29)27-31-25-13-9-10-14-26(25)35(27)28(22)32-30-16-24-19(3)33-34(20(24)4)17-21-11-7-6-8-12-21/h6-14,16,32H,5,17H2,1-4H3/b30-16- |
| InChIKey | VQSVMPDVTSJZJS-UHBFCERESA-N |
| XLogP | 5.54 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|