C9H10N2O — CID 137200582
3-ethyl-1H-pyrrolo[3,2-b]pyridin-2-ol (PubChem CID 137200582) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-ethyl-1H-pyrrolo[3,2-b]pyridin-2-ol.
| Compound Name | 3-ethyl-1H-pyrrolo[3,2-b]pyridin-2-ol |
|---|---|
| PubChem CID | 137200582 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-ethyl-1H-pyrrolo[3,2-b]pyridin-2-ol |
| SMILES | CCc1c(O)[nH]c2cccnc12 |
| InChI | InChI=1S/C9H10N2O/c1-2-6-8-7(11-9(6)12)4-3-5-10-8/h3-5,11-12H,2H2,1H3 |
| InChIKey | GAXHGYODLSOJJR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |