About 5H-pyrido[3,2-b]indol-8-ol
5H-pyrido[3,2-b]indol-8-ol (PubChem CID 10511693) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 5H-pyrido[3,2-b]indol-8-ol.
Molecular Properties
| Compound Name | 5H-pyrido[3,2-b]indol-8-ol |
| PubChem CID | 10511693 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5H-pyrido[3,2-b]indol-8-ol |
| SMILES | Oc1ccc2[nH]c3cccnc3c2c1 |
| InChI | InChI=1S/C11H8N2O/c14-7-3-4-9-8(6-7)11-10(13-9)2-1-5-12-11/h1-6,13-14H |
| InChIKey | NYZURWHDDKWNDP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrido[3,2-b]indol-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[3,2-b]indol-8-ol?
The IUPAC name of 5H-pyrido[3,2-b]indol-8-ol (CID 10511693) is 5H-pyrido[3,2-b]indol-8-ol.
What is the SMILES notation for 5H-pyrido[3,2-b]indol-8-ol?
The canonical SMILES for 5H-pyrido[3,2-b]indol-8-ol is Oc1ccc2[nH]c3cccnc3c2c1.
What is the InChIKey of 5H-pyrido[3,2-b]indol-8-ol?
The InChIKey is NYZURWHDDKWNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-7-3-4-9-8(6-7)11-10(13-9)2-1-5-12-11/h1-6,13-14H.
What are the key properties of 5H-pyrido[3,2-b]indol-8-ol?
5H-pyrido[3,2-b]indol-8-ol has a molecular weight of 184.20 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[3,2-b]indol-8-ol is sourced from PubChem (CID 10511693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).