C14H14N2O5 — CID 57068684
diethyl 4-oxo-1H-1,5-naphthyridine-2,3-dicarboxylate (PubChem CID 57068684) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is diethyl 4-oxo-1H-1,5-naphthyridine-2,3-dicarboxylate.
| Compound Name | diethyl 4-oxo-1H-1,5-naphthyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 57068684 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | diethyl 4-oxo-1H-1,5-naphthyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c2cccnc2c(=O)c1C(=O)OCC |
| InChI | InChI=1S/C14H14N2O5/c1-3-20-13(18)9-11(14(19)21-4-2)16-8-6-5-7-15-10(8)12(9)17/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | CGIOQMJZTIBQBT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |