C13H14N2O5 — CID 19977741
diethyl 1-hydroxypyrrolo[3,2-b]pyridine-2,3-dicarboxylate (PubChem CID 19977741) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is diethyl 1-hydroxypyrrolo[3,2-b]pyridine-2,3-dicarboxylate.
| Compound Name | diethyl 1-hydroxypyrrolo[3,2-b]pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 19977741 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | diethyl 1-hydroxypyrrolo[3,2-b]pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)n(O)c2cccnc12 |
| InChI | InChI=1S/C13H14N2O5/c1-3-19-12(16)9-10-8(6-5-7-14-10)15(18)11(9)13(17)20-4-2/h5-7,18H,3-4H2,1-2H3 |
| InChIKey | SBSRYMXZQMEFMF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|