C28H21ClN2O5 — CID 45051509
diethyl 11-(4-chlorobenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate (PubChem CID 45051509) has the molecular formula C28H21ClN2O5 and a molecular weight of 500.94 g/mol. Its IUPAC name is diethyl 11-(4-chlorobenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate.
| Compound Name | diethyl 11-(4-chlorobenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate |
|---|---|
| PubChem CID | 45051509 |
| Molecular Formula | C28H21ClN2O5 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | diethyl 11-(4-chlorobenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2ccc3ccc4cccnc4c3n2c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H21ClN2O5/c1-3-35-27(33)21-20-14-11-17-8-7-16-6-5-15-30-23(16)24(17)31(20)25(22(21)28(34)36-4-2)26(32)18-9-12-19(29)13-10-18/h5-15H,3-4H2,1-2H3 |
| InChIKey | KHUSRWZYYNYGDG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|