C27H20N2O6 — CID 102503087
dimethyl 3-(4-methoxybenzoyl)pyrrolo[1,2-i][1,7]phenanthroline-1,2-dicarboxylate (PubChem CID 102503087) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is dimethyl 3-(4-methoxybenzoyl)pyrrolo[1,2-i][1,7]phenanthroline-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(4-methoxybenzoyl)pyrrolo[1,2-i][1,7]phenanthroline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102503087 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | dimethyl 3-(4-methoxybenzoyl)pyrrolo[1,2-i][1,7]phenanthroline-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3c4ncccc4ccc3n2c1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H20N2O6/c1-33-17-9-6-16(7-10-17)25(30)24-22(27(32)35-3)21(26(31)34-2)20-13-11-18-19(29(20)24)12-8-15-5-4-14-28-23(15)18/h4-14H,1-3H3 |
| InChIKey | SIISGTWNAOJFBJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|