C17H13NO4 — CID 136706022
(5,8-dihydroxyquinolin-6-yl)-(4-methoxyphenyl)methanone (PubChem CID 136706022) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (5,8-dihydroxyquinolin-6-yl)-(4-methoxyphenyl)methanone.
| Compound Name | (5,8-dihydroxyquinolin-6-yl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 136706022 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (5,8-dihydroxyquinolin-6-yl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(O)c3ncccc3c2O)cc1 |
| InChI | InChI=1S/C17H13NO4/c1-22-11-6-4-10(5-7-11)16(20)13-9-14(19)15-12(17(13)21)3-2-8-18-15/h2-9,19,21H,1H3 |
| InChIKey | XFHMZTPJGLDHRF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|