C16H16O5 — CID 56666166
(3-hydroxy-2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone (PubChem CID 56666166) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (3-hydroxy-2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone.
| Compound Name | (3-hydroxy-2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 56666166 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (3-hydroxy-2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(OC)c(O)c2OC)cc1 |
| InChI | InChI=1S/C16H16O5/c1-19-11-6-4-10(5-7-11)14(17)12-8-9-13(20-2)15(18)16(12)21-3/h4-9,18H,1-3H3 |
| InChIKey | GRGVDRVIEYNXKK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |