C31H21NO5 — CID 3699630
dimethyl 3-(naphthalene-2-carbonyl)naphtho[2,1-e]indolizine-1,2-dicarboxylate (PubChem CID 3699630) has the molecular formula C31H21NO5 and a molecular weight of 487.51 g/mol. Its IUPAC name is dimethyl 3-(naphthalene-2-carbonyl)naphtho[2,1-e]indolizine-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(naphthalene-2-carbonyl)naphtho[2,1-e]indolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 3699630 |
| Molecular Formula | C31H21NO5 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | dimethyl 3-(naphthalene-2-carbonyl)naphtho[2,1-e]indolizine-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3c4ccccc4ccc3n2c1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H21NO5/c1-36-30(34)26-25-16-14-23-22-10-6-5-8-19(22)13-15-24(23)32(25)28(27(26)31(35)37-2)29(33)21-12-11-18-7-3-4-9-20(18)17-21/h3-17H,1-2H3 |
| InChIKey | MZQXRKJCKXFGEV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|